C27H35N3O7 — CID 154672437
tert-butyl 6-[2-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenoxy]ethyl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 154672437) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is tert-butyl 6-[2-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenoxy]ethyl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[2-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenoxy]ethyl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 154672437 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | tert-butyl 6-[2-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenoxy]ethyl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | Cc1cc(OCCC2CC3(C2)CN(C(=O)OC(C)(C)C)C3)ccc1C(=O)N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C27H35N3O7/c1-17-11-19(5-6-20(17)24(34)30(16-31)21-7-8-22(32)28-23(21)33)36-10-9-18-12-27(13-18)14-29(15-27)25(35)37-26(2,3)4/h5-6,11,16,18,21H,7-10,12-15H2,1-4H3,(H,28,32,33) |
| InChIKey | JZOIZHSMQCXXML-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|