C29H38N4O6 — CID 176695445
[2-[[1-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenyl]piperidin-4-yl]methyl]-2-azaspiro[3.5]nonan-7-yl] formate (PubChem CID 176695445) has the molecular formula C29H38N4O6 and a molecular weight of 538.65 g/mol. Its IUPAC name is [2-[[1-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenyl]piperidin-4-yl]methyl]-2-azaspiro[3.5]nonan-7-yl] formate.
| Compound Name | [2-[[1-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenyl]piperidin-4-yl]methyl]-2-azaspiro[3.5]nonan-7-yl] formate |
|---|---|
| PubChem CID | 176695445 |
| Molecular Formula | C29H38N4O6 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | [2-[[1-[4-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-3-methylphenyl]piperidin-4-yl]methyl]-2-azaspiro[3.5]nonan-7-yl] formate |
| SMILES | Cc1cc(N2CCC(CN3CC4(CCC(OC=O)CC4)C3)CC2)ccc1C(=O)N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C29H38N4O6/c1-20-14-22(2-3-24(20)28(38)33(18-34)25-4-5-26(36)30-27(25)37)32-12-8-21(9-13-32)15-31-16-29(17-31)10-6-23(7-11-29)39-19-35/h2-3,14,18-19,21,23,25H,4-13,15-17H2,1H3,(H,30,36,37) |
| InChIKey | YSKZCYLPDGVFMZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|