C20H23N3O5 — CID 174298906
N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-5-[3-(2-oxoethyl)pyrrolidin-1-yl]benzamide (PubChem CID 174298906) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-5-[3-(2-oxoethyl)pyrrolidin-1-yl]benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-5-[3-(2-oxoethyl)pyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 174298906 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-5-[3-(2-oxoethyl)pyrrolidin-1-yl]benzamide |
| SMILES | CN(C(=O)c1cc(N2CCC(CC=O)C2)ccc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H23N3O5/c1-22(17-4-5-18(26)21-19(17)27)20(28)16-10-15(3-2-14(16)12-25)23-8-6-13(11-23)7-9-24/h2-3,9-10,12-13,17H,4-8,11H2,1H3,(H,21,26,27) |
| InChIKey | COVQCTLPKLIPMB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|