C19H23N3O5 — CID 178155469
N-(2,6-dioxopiperidin-3-yl)-2-formyl-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide (PubChem CID 178155469) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-formyl-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 178155469 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide |
| SMILES | O=Cc1ccc(N2CCC(CO)CC2)cc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H23N3O5/c23-10-12-5-7-22(8-6-12)14-2-1-13(11-24)15(9-14)18(26)20-16-3-4-17(25)21-19(16)27/h1-2,9,11-12,16,23H,3-8,10H2,(H,20,26)(H,21,25,27) |
| InChIKey | VVXABQAIBFFQHT-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|