C12H12N2O4 — CID 141087093
N-[(3S)-2,6-dioxopiperidin-3-yl]-2-hydroxybenzamide (PubChem CID 141087093) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxopiperidin-3-yl]-2-hydroxybenzamide.
| Compound Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 141087093 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-2-hydroxybenzamide |
| SMILES | O=C1CC[C@H](NC(=O)c2ccccc2O)C(=O)N1 |
| InChI | InChI=1S/C12H12N2O4/c15-9-4-2-1-3-7(9)11(17)13-8-5-6-10(16)14-12(8)18/h1-4,8,15H,5-6H2,(H,13,17)(H,14,16,18)/t8-/m0/s1 |
| InChIKey | VHKAULMYIVRQFG-QMMMGPOBSA-N |
| XLogP | -0.07 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|