C13H12N4O3 — CID 153384900
N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 153384900) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153384900 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cccc3[nH]cnc23)C(=O)N1 |
| InChI | InChI=1S/C13H12N4O3/c18-10-5-4-9(13(20)17-10)16-12(19)7-2-1-3-8-11(7)15-6-14-8/h1-3,6,9H,4-5H2,(H,14,15)(H,16,19)(H,17,18,20) |
| InChIKey | QXJAOYHMIOBQNK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|