C9H10N4O3 — CID 110475285
N-(2,6-dioxopiperidin-3-yl)-1H-imidazole-5-carboxamide (PubChem CID 110475285) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-1H-imidazole-5-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 110475285 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-1H-imidazole-5-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cnc[nH]2)C(=O)N1 |
| InChI | InChI=1S/C9H10N4O3/c14-7-2-1-5(8(15)13-7)12-9(16)6-3-10-4-11-6/h3-5H,1-2H2,(H,10,11)(H,12,16)(H,13,14,15) |
| InChIKey | AHRLNLUFWCOJES-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|