C10H10N4O3 — CID 156797860
N-[(3S)-2,6-dioxopiperidin-3-yl]pyrimidine-2-carboxamide (PubChem CID 156797860) has the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxopiperidin-3-yl]pyrimidine-2-carboxamide.
| Compound Name | N-[(3S)-2,6-dioxopiperidin-3-yl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 156797860 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-[(3S)-2,6-dioxopiperidin-3-yl]pyrimidine-2-carboxamide |
| SMILES | O=C1CC[C@H](NC(=O)c2ncccn2)C(=O)N1 |
| InChI | InChI=1S/C10H10N4O3/c15-7-3-2-6(9(16)14-7)13-10(17)8-11-4-1-5-12-8/h1,4-6H,2-3H2,(H,13,17)(H,14,15,16)/t6-/m0/s1 |
| InChIKey | GHZFKQZRIJWUSQ-LURJTMIESA-N |
| XLogP | -0.99 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|