C12H12N4O5 — CID 104743728
3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]pyridine-2-carboxylic acid (PubChem CID 104743728) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]pyridine-2-carboxylic acid.
| Compound Name | 3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104743728 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]pyridine-2-carboxylic acid |
| SMILES | O=C1CCC(NC(=O)Nc2cccnc2C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C12H12N4O5/c17-8-4-3-7(10(18)16-8)15-12(21)14-6-2-1-5-13-9(6)11(19)20/h1-2,5,7H,3-4H2,(H,19,20)(H2,14,15,21)(H,16,17,18) |
| InChIKey | FXTTZFZFKURVMZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|