C14H18N2O3 — CID 156866709
N-(2,6-dioxopiperidin-3-yl)benzamide;ethane (PubChem CID 156866709) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)benzamide;ethane.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)benzamide;ethane |
|---|---|
| PubChem CID | 156866709 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)benzamide;ethane |
| SMILES | CC.O=C1CCC(NC(=O)c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C12H12N2O3.C2H6/c15-10-7-6-9(12(17)14-10)13-11(16)8-4-2-1-3-5-8;1-2/h1-5,9H,6-7H2,(H,13,16)(H,14,15,17);1-2H3 |
| InChIKey | BYJMIHPAGSPHCA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|