C15H18N2O3 — CID 168945690
N-(2,6-dioxopiperidin-3-yl)-4-propylbenzamide (PubChem CID 168945690) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-propylbenzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-propylbenzamide |
|---|---|
| PubChem CID | 168945690 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-propylbenzamide |
| SMILES | CCCc1ccc(C(=O)NC2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C15H18N2O3/c1-2-3-10-4-6-11(7-5-10)14(19)16-12-8-9-13(18)17-15(12)20/h4-7,12H,2-3,8-9H2,1H3,(H,16,19)(H,17,18,20) |
| InChIKey | LKYGDKHNEDHRBM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|