C13H13ClN2O3 — CID 110186635
2-(4-chlorophenyl)-N-[(3S)-2,6-dioxopiperidin-3-yl]acetamide (PubChem CID 110186635) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3S)-2,6-dioxopiperidin-3-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(3S)-2,6-dioxopiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 110186635 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3S)-2,6-dioxopiperidin-3-yl]acetamide |
| SMILES | O=C1CC[C@H](NC(=O)Cc2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C13H13ClN2O3/c14-9-3-1-8(2-4-9)7-12(18)15-10-5-6-11(17)16-13(10)19/h1-4,10H,5-7H2,(H,15,18)(H,16,17,19)/t10-/m0/s1 |
| InChIKey | BSGHJBBTSRDBNI-JTQLQIEISA-N |
| XLogP | 0.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|