C15H15N3O4 — CID 154591725
N-[(3R)-2,6-dioxopiperidin-3-yl]-2-(2-oxo-1,3-dihydroindol-5-yl)acetamide (PubChem CID 154591725) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is N-[(3R)-2,6-dioxopiperidin-3-yl]-2-(2-oxo-1,3-dihydroindol-5-yl)acetamide.
| Compound Name | N-[(3R)-2,6-dioxopiperidin-3-yl]-2-(2-oxo-1,3-dihydroindol-5-yl)acetamide |
|---|---|
| PubChem CID | 154591725 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(3R)-2,6-dioxopiperidin-3-yl]-2-(2-oxo-1,3-dihydroindol-5-yl)acetamide |
| SMILES | O=C1CC[C@@H](NC(=O)Cc2ccc3c(c2)CC(=O)N3)C(=O)N1 |
| InChI | InChI=1S/C15H15N3O4/c19-12-4-3-11(15(22)18-12)17-13(20)6-8-1-2-10-9(5-8)7-14(21)16-10/h1-2,5,11H,3-4,6-7H2,(H,16,21)(H,17,20)(H,18,19,22)/t11-/m1/s1 |
| InChIKey | MIWPDHSPCQNWKP-LLVKDONJSA-N |
| XLogP | -0.35 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|