C13H14N2O2 — CID 110768065
2-(2-oxo-1,3-dihydroindol-5-yl)-N-prop-2-enylacetamide (PubChem CID 110768065) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroindol-5-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(2-oxo-1,3-dihydroindol-5-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 110768065 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(2-oxo-1,3-dihydroindol-5-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H14N2O2/c1-2-5-14-12(16)7-9-3-4-11-10(6-9)8-13(17)15-11/h2-4,6H,1,5,7-8H2,(H,14,16)(H,15,17) |
| InChIKey | XUKKWQYXOZPPPY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|