C17H13F3N2O2 — CID 110768191
2-(2-oxo-1,3-dihydroindol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 110768191) has the molecular formula C17H13F3N2O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroindol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-oxo-1,3-dihydroindol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110768191 |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(2-oxo-1,3-dihydroindol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)CC(=O)N2)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N2O2/c18-17(19,20)12-2-4-13(5-3-12)21-15(23)8-10-1-6-14-11(7-10)9-16(24)22-14/h1-7H,8-9H2,(H,21,23)(H,22,24) |
| InChIKey | FHDRJDQUXOAAPD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |