C16H12F3NO3 — CID 110860892
2-(1,3-benzodioxol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 110860892) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110860892 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3NO3/c17-16(18,19)11-2-4-12(5-3-11)20-15(21)8-10-1-6-13-14(7-10)23-9-22-13/h1-7H,8-9H2,(H,20,21) |
| InChIKey | YTOJUFAXAJSMKL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |