C16H12F3NO2S2 — CID 3542904
1,3-benzodioxol-5-ylmethyl N-[4-(trifluoromethyl)phenyl]carbamodithioate (PubChem CID 3542904) has the molecular formula C16H12F3NO2S2 and a molecular weight of 371.41 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl N-[4-(trifluoromethyl)phenyl]carbamodithioate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl N-[4-(trifluoromethyl)phenyl]carbamodithioate |
|---|---|
| PubChem CID | 3542904 |
| Molecular Formula | C16H12F3NO2S2 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl N-[4-(trifluoromethyl)phenyl]carbamodithioate |
| SMILES | FC(F)(F)c1ccc(NC(=S)SCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H12F3NO2S2/c17-16(18,19)11-2-4-12(5-3-11)20-15(23)24-8-10-1-6-13-14(7-10)22-9-21-13/h1-7H,8-9H2,(H,20,23) |
| InChIKey | LUHMTCMXITUGBS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|