C16H14ClNO2S2 — CID 4212341
1,3-benzodioxol-5-ylmethyl N-(4-chloro-3-methylphenyl)carbamodithioate (PubChem CID 4212341) has the molecular formula C16H14ClNO2S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl N-(4-chloro-3-methylphenyl)carbamodithioate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl N-(4-chloro-3-methylphenyl)carbamodithioate |
|---|---|
| PubChem CID | 4212341 |
| Molecular Formula | C16H14ClNO2S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl N-(4-chloro-3-methylphenyl)carbamodithioate |
| SMILES | Cc1cc(NC(=S)SCc2ccc3c(c2)OCO3)ccc1Cl |
| InChI | InChI=1S/C16H14ClNO2S2/c1-10-6-12(3-4-13(10)17)18-16(21)22-8-11-2-5-14-15(7-11)20-9-19-14/h2-7H,8-9H2,1H3,(H,18,21) |
| InChIKey | FCHHNMMZWQDEIZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|