C22H26ClN3O2S — CID 4614049
1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chloro-4-methylphenyl)-1-(1-methylpiperidin-4-yl)thiourea (PubChem CID 4614049) has the molecular formula C22H26ClN3O2S and a molecular weight of 431.99 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chloro-4-methylphenyl)-1-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chloro-4-methylphenyl)-1-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 4614049 |
| Molecular Formula | C22H26ClN3O2S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chloro-4-methylphenyl)-1-(1-methylpiperidin-4-yl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccc3c(c2)OCO3)C2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C22H26ClN3O2S/c1-15-3-5-17(12-19(15)23)24-22(29)26(18-7-9-25(2)10-8-18)13-16-4-6-20-21(11-16)28-14-27-20/h3-6,11-12,18H,7-10,13-14H2,1-2H3,(H,24,29) |
| InChIKey | KBKVRVSPMDABNI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|