C20H25ClN4S — CID 100749129
1-(3-chloro-4-methylphenyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiourea (PubChem CID 100749129) has the molecular formula C20H25ClN4S and a molecular weight of 388.97 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 100749129 |
| Molecular Formula | C20H25ClN4S |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCc2ccc(N3CCN(C)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C20H25ClN4S/c1-15-3-6-17(13-19(15)21)23-20(26)22-14-16-4-7-18(8-5-16)25-11-9-24(2)10-12-25/h3-8,13H,9-12,14H2,1-2H3,(H2,22,23,26) |
| InChIKey | RWLIXKLFJCPWHM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|