C16H16Cl2N2S — CID 19649646
1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)ethyl]thiourea (PubChem CID 19649646) has the molecular formula C16H16Cl2N2S and a molecular weight of 339.29 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19649646 |
| Molecular Formula | C16H16Cl2N2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)ethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCCc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2S/c1-11-2-7-14(10-15(11)18)20-16(21)19-9-8-12-3-5-13(17)6-4-12/h2-7,10H,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | PWKUIDWNCLPPNP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|