C18H28N2O2S — CID 19653308
3-(1,3-benzodioxol-5-yl)-1,1-dipentylthiourea (PubChem CID 19653308) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1,1-dipentylthiourea.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1,1-dipentylthiourea |
|---|---|
| PubChem CID | 19653308 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1,1-dipentylthiourea |
| SMILES | CCCCCN(CCCCC)C(=S)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H28N2O2S/c1-3-5-7-11-20(12-8-6-4-2)18(23)19-15-9-10-16-17(13-15)22-14-21-16/h9-10,13H,3-8,11-12,14H2,1-2H3,(H,19,23) |
| InChIKey | SSBWOIXJQXFUAT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|