C16H22N2O4 — CID 113115878
3-[acetyl(butyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide (PubChem CID 113115878) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-[acetyl(butyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide.
| Compound Name | 3-[acetyl(butyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 113115878 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-[acetyl(butyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide |
| SMILES | CCCCN(CCC(=O)Nc1ccc2c(c1)OCO2)C(C)=O |
| InChI | InChI=1S/C16H22N2O4/c1-3-4-8-18(12(2)19)9-7-16(20)17-13-5-6-14-15(10-13)22-11-21-14/h5-6,10H,3-4,7-9,11H2,1-2H3,(H,17,20) |
| InChIKey | QFAHJJPORVWGTE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |