C17H24N2O4 — CID 113123152
3-[acetyl(pentyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide (PubChem CID 113123152) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-[acetyl(pentyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide.
| Compound Name | 3-[acetyl(pentyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 113123152 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-[acetyl(pentyl)amino]-N-(1,3-benzodioxol-5-yl)propanamide |
| SMILES | CCCCCN(CCC(=O)Nc1ccc2c(c1)OCO2)C(C)=O |
| InChI | InChI=1S/C17H24N2O4/c1-3-4-5-9-19(13(2)20)10-8-17(21)18-14-6-7-15-16(11-14)23-12-22-15/h6-7,11H,3-5,8-10,12H2,1-2H3,(H,18,21) |
| InChIKey | MYDARGPORQOAGH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|