C23H21ClN2O2S — CID 44665570
1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(2-chloro-5-methylphenyl)thiourea (PubChem CID 44665570) has the molecular formula C23H21ClN2O2S and a molecular weight of 424.95 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(2-chloro-5-methylphenyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(2-chloro-5-methylphenyl)thiourea |
|---|---|
| PubChem CID | 44665570 |
| Molecular Formula | C23H21ClN2O2S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(2-chloro-5-methylphenyl)thiourea |
| SMILES | Cc1ccc(Cl)c(NC(=S)N(Cc2ccccc2)Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C23H21ClN2O2S/c1-16-7-9-19(24)20(11-16)25-23(29)26(13-17-5-3-2-4-6-17)14-18-8-10-21-22(12-18)28-15-27-21/h2-12H,13-15H2,1H3,(H,25,29) |
| InChIKey | DPLSZEDIRCVNRL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|