C23H22Cl2N2S — CID 3320668
1-benzyl-1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 3320668) has the molecular formula C23H22Cl2N2S and a molecular weight of 429.42 g/mol. Its IUPAC name is 1-benzyl-1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-benzyl-1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 3320668 |
| Molecular Formula | C23H22Cl2N2S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-benzyl-1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccccc2)Cc2ccc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C23H22Cl2N2S/c1-16-8-11-22(17(2)12-16)26-23(28)27(14-18-6-4-3-5-7-18)15-19-9-10-20(24)13-21(19)25/h3-13H,14-15H2,1-2H3,(H,26,28) |
| InChIKey | GWYDPLXEICLIIW-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|