C22H21Cl2N3O2S — CID 4228715
1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4228715) has the molecular formula C22H21Cl2N3O2S and a molecular weight of 462.40 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4228715 |
| Molecular Formula | C22H21Cl2N3O2S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-(2,4-dimethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2cccnc2)Cc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H21Cl2N3O2S/c1-28-18-7-8-20(21(11-18)29-2)26-22(30)27(13-15-4-3-9-25-12-15)14-16-5-6-17(23)10-19(16)24/h3-12H,13-14H2,1-2H3,(H,26,30) |
| InChIKey | WAFJBKLQGSKXIE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|