C21H19ClFN3OS — CID 3533651
1-[(2-chloro-6-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3533651) has the molecular formula C21H19ClFN3OS and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3533651 |
| Molecular Formula | C21H19ClFN3OS |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(Cc2cccnc2)Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C21H19ClFN3OS/c1-27-17-7-2-6-16(11-17)25-21(28)26(13-15-5-4-10-24-12-15)14-18-19(22)8-3-9-20(18)23/h2-12H,13-14H2,1H3,(H,25,28) |
| InChIKey | FNZIIWVZXFHVOO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|