C22H22FN3OS — CID 3648382
3-(4-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3648382) has the molecular formula C22H22FN3OS and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3648382 |
| Molecular Formula | C22H22FN3OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2cccnc2)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C22H22FN3OS/c1-2-27-20-11-9-19(10-12-20)25-22(28)26(15-17-6-5-13-24-14-17)16-18-7-3-4-8-21(18)23/h3-14H,2,15-16H2,1H3,(H,25,28) |
| InChIKey | NGPMYWIMXNLQKE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|