C22H27N3OS — CID 3258546
1-(cyclohex-3-en-1-ylmethyl)-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3258546) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3258546 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2cccnc2)CC2CC=CCC2)cc1 |
| InChI | InChI=1S/C22H27N3OS/c1-2-26-21-12-10-20(11-13-21)24-22(27)25(16-18-7-4-3-5-8-18)17-19-9-6-14-23-15-19/h3-4,6,9-15,18H,2,5,7-8,16-17H2,1H3,(H,24,27) |
| InChIKey | ZPXZCQNVJANJBX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|