C17H25N3S — CID 27492585
1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 27492585) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 27492585 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCCNC(=S)N(Cc1cccnc1)C[C@H]1CC=CCC1 |
| InChI | InChI=1S/C17H25N3S/c1-2-10-19-17(21)20(13-15-7-4-3-5-8-15)14-16-9-6-11-18-12-16/h3-4,6,9,11-12,15H,2,5,7-8,10,13-14H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | BUBNAENHZIDTON-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|