C21H21ClF3N3S — CID 22781147
3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 22781147) has the molecular formula C21H21ClF3N3S and a molecular weight of 439.93 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 22781147 |
| Molecular Formula | C21H21ClF3N3S |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | FC(F)(F)c1ccc(Cl)c(NC(=S)N(Cc2cccnc2)CC2CC=CCC2)c1 |
| InChI | InChI=1S/C21H21ClF3N3S/c22-18-9-8-17(21(23,24)25)11-19(18)27-20(29)28(13-15-5-2-1-3-6-15)14-16-7-4-10-26-12-16/h1-2,4,7-12,15H,3,5-6,13-14H2,(H,27,29) |
| InChIKey | QBQVPQASFBQVDB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|