C17H18ClN3S — CID 17132518
3-(2-chloro-5-methylphenyl)-1-cyclopropyl-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 17132518) has the molecular formula C17H18ClN3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 3-(2-chloro-5-methylphenyl)-1-cyclopropyl-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2-chloro-5-methylphenyl)-1-cyclopropyl-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17132518 |
| Molecular Formula | C17H18ClN3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3-(2-chloro-5-methylphenyl)-1-cyclopropyl-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1ccc(Cl)c(NC(=S)N(Cc2cccnc2)C2CC2)c1 |
| InChI | InChI=1S/C17H18ClN3S/c1-12-4-7-15(18)16(9-12)20-17(22)21(14-5-6-14)11-13-3-2-8-19-10-13/h2-4,7-10,14H,5-6,11H2,1H3,(H,20,22) |
| InChIKey | IXKDQHWHMGSTMW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|