C22H28Cl2N4S — CID 17376961
3-(2,5-dichlorophenyl)-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17376961) has the molecular formula C22H28Cl2N4S and a molecular weight of 451.47 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 3-(2,5-dichlorophenyl)-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17376961 |
| Molecular Formula | C22H28Cl2N4S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(N(Cc2cccnc2)C(=S)Nc2cc(Cl)ccc2Cl)CC(C)(C)N1 |
| InChI | InChI=1S/C22H28Cl2N4S/c1-21(2)11-17(12-22(3,4)27-21)28(14-15-6-5-9-25-13-15)20(29)26-19-10-16(23)7-8-18(19)24/h5-10,13,17,27H,11-12,14H2,1-4H3,(H,26,29) |
| InChIKey | ADECCIAVMUMFMP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|