C25H34FN3S — CID 17371005
3-(2,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17371005) has the molecular formula C25H34FN3S and a molecular weight of 427.63 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 3-(2,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17371005 |
| Molecular Formula | C25H34FN3S |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N(Cc2ccc(F)cc2)C2CC(C)(C)NC(C)(C)C2)c1 |
| InChI | InChI=1S/C25H34FN3S/c1-17-7-8-18(2)22(13-17)27-23(30)29(16-19-9-11-20(26)12-10-19)21-14-24(3,4)28-25(5,6)15-21/h7-13,21,28H,14-16H2,1-6H3,(H,27,30) |
| InChIKey | NZBAPFVVQULVRE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|