C19H20F2N2S — CID 3369865
1-cyclopentyl-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]thiourea (PubChem CID 3369865) has the molecular formula C19H20F2N2S and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-cyclopentyl-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3369865 |
| Molecular Formula | C19H20F2N2S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-cyclopentyl-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccc(CN(C(=S)Nc2ccc(F)cc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H20F2N2S/c20-15-7-5-14(6-8-15)13-23(18-3-1-2-4-18)19(24)22-17-11-9-16(21)10-12-17/h5-12,18H,1-4,13H2,(H,22,24) |
| InChIKey | CVGWSBFTMOTYKS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|