C23H28FN3O2 — CID 8834579
(2S)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-(phenylcarbamoylamino)propanamide (PubChem CID 8834579) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-(phenylcarbamoylamino)propanamide.
| Compound Name | (2S)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 8834579 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (2S)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-(phenylcarbamoylamino)propanamide |
| SMILES | C[C@H](NC(=O)Nc1ccccc1)C(=O)N(Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-17(25-23(29)26-20-8-4-2-5-9-20)22(28)27(21-10-6-3-7-11-21)16-18-12-14-19(24)15-13-18/h2,4-5,8-9,12-15,17,21H,3,6-7,10-11,16H2,1H3,(H2,25,26,29)/t17-/m0/s1 |
| InChIKey | ZYZHUUKNBMKHOR-KRWDZBQOSA-N |
| XLogP | 4.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |