C23H21FN2S — CID 3478591
1-cyclopropyl-1-[(2-fluorophenyl)methyl]-3-(4-phenylphenyl)thiourea (PubChem CID 3478591) has the molecular formula C23H21FN2S and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(2-fluorophenyl)methyl]-3-(4-phenylphenyl)thiourea.
| Compound Name | 1-cyclopropyl-1-[(2-fluorophenyl)methyl]-3-(4-phenylphenyl)thiourea |
|---|---|
| PubChem CID | 3478591 |
| Molecular Formula | C23H21FN2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-cyclopropyl-1-[(2-fluorophenyl)methyl]-3-(4-phenylphenyl)thiourea |
| SMILES | Fc1ccccc1CN(C(=S)Nc1ccc(-c2ccccc2)cc1)C1CC1 |
| InChI | InChI=1S/C23H21FN2S/c24-22-9-5-4-8-19(22)16-26(21-14-15-21)23(27)25-20-12-10-18(11-13-20)17-6-2-1-3-7-17/h1-13,21H,14-16H2,(H,25,27) |
| InChIKey | AAQQIUVVIUYDJE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|