C20H20F4N2S — CID 17132989
1-cyclopentyl-1-[(2-fluorophenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 17132989) has the molecular formula C20H20F4N2S and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(2-fluorophenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-cyclopentyl-1-[(2-fluorophenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17132989 |
| Molecular Formula | C20H20F4N2S |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-cyclopentyl-1-[(2-fluorophenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | Fc1ccccc1CN(C(=S)Nc1ccccc1C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C20H20F4N2S/c21-17-11-5-1-7-14(17)13-26(15-8-2-3-9-15)19(27)25-18-12-6-4-10-16(18)20(22,23)24/h1,4-7,10-12,15H,2-3,8-9,13H2,(H,25,27) |
| InChIKey | GDCOMZCIJNZXTR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|