C26H34FN3OS — CID 92695641
2-[[cyclohexyl-[(2-fluorophenyl)methyl]carbamothioyl]amino]-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 92695641) has the molecular formula C26H34FN3OS and a molecular weight of 455.64 g/mol. Its IUPAC name is 2-[[cyclohexyl-[(2-fluorophenyl)methyl]carbamothioyl]amino]-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[[cyclohexyl-[(2-fluorophenyl)methyl]carbamothioyl]amino]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 92695641 |
| Molecular Formula | C26H34FN3OS |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[[cyclohexyl-[(2-fluorophenyl)methyl]carbamothioyl]amino]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CNC(=S)N(Cc1ccccc1F)C1CCCCC1 |
| InChI | InChI=1S/C26H34FN3OS/c1-20(16-17-21-10-4-2-5-11-21)29-25(31)18-28-26(32)30(23-13-6-3-7-14-23)19-22-12-8-9-15-24(22)27/h2,4-5,8-12,15,20,23H,3,6-7,13-14,16-19H2,1H3,(H,28,32)(H,29,31)/t20-/m0/s1 |
| InChIKey | XDUPQFCYIFKRNA-FQEVSTJZSA-N |
| XLogP | 4.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|