C24H29ClFN3OS — CID 46371665
N-[2-(2-chlorophenyl)ethyl]-2-[[cyclohexyl-[(4-fluorophenyl)methyl]carbamothioyl]amino]acetamide (PubChem CID 46371665) has the molecular formula C24H29ClFN3OS and a molecular weight of 462.03 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-2-[[cyclohexyl-[(4-fluorophenyl)methyl]carbamothioyl]amino]acetamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-2-[[cyclohexyl-[(4-fluorophenyl)methyl]carbamothioyl]amino]acetamide |
|---|---|
| PubChem CID | 46371665 |
| Molecular Formula | C24H29ClFN3OS |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-2-[[cyclohexyl-[(4-fluorophenyl)methyl]carbamothioyl]amino]acetamide |
| SMILES | O=C(CNC(=S)N(Cc1ccc(F)cc1)C1CCCCC1)NCCc1ccccc1Cl |
| InChI | InChI=1S/C24H29ClFN3OS/c25-22-9-5-4-6-19(22)14-15-27-23(30)16-28-24(31)29(21-7-2-1-3-8-21)17-18-10-12-20(26)13-11-18/h4-6,9-13,21H,1-3,7-8,14-17H2,(H,27,30)(H,28,31) |
| InChIKey | HXOVZORWISQHHL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|