C20H30FN3O2 — CID 8684133
2-[[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]acetyl]amino]-N-propylacetamide (PubChem CID 8684133) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-[[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]acetyl]amino]-N-propylacetamide.
| Compound Name | 2-[[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]acetyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 8684133 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-[[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]acetyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNC(=O)CN(Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H30FN3O2/c1-2-12-22-19(25)13-23-20(26)15-24(18-6-4-3-5-7-18)14-16-8-10-17(21)11-9-16/h8-11,18H,2-7,12-15H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | JLXSCDNIFIDNRD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |