C15H20FNO2 — CID 79006293
methyl 2-[cyclopentyl-[(4-fluorophenyl)methyl]amino]acetate (PubChem CID 79006293) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl 2-[cyclopentyl-[(4-fluorophenyl)methyl]amino]acetate.
| Compound Name | methyl 2-[cyclopentyl-[(4-fluorophenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 79006293 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | methyl 2-[cyclopentyl-[(4-fluorophenyl)methyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C15H20FNO2/c1-19-15(18)11-17(14-4-2-3-5-14)10-12-6-8-13(16)9-7-12/h6-9,14H,2-5,10-11H2,1H3 |
| InChIKey | VMZXWETVPKGVPB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |