C15H19ClFNO2 — CID 80709366
methyl 2-[(2-chloro-4-fluorophenyl)methyl-cyclopentylamino]acetate (PubChem CID 80709366) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is methyl 2-[(2-chloro-4-fluorophenyl)methyl-cyclopentylamino]acetate.
| Compound Name | methyl 2-[(2-chloro-4-fluorophenyl)methyl-cyclopentylamino]acetate |
|---|---|
| PubChem CID | 80709366 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | methyl 2-[(2-chloro-4-fluorophenyl)methyl-cyclopentylamino]acetate |
| SMILES | COC(=O)CN(Cc1ccc(F)cc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H19ClFNO2/c1-20-15(19)10-18(13-4-2-3-5-13)9-11-6-7-12(17)8-14(11)16/h6-8,13H,2-5,9-10H2,1H3 |
| InChIKey | QRBKPUPLVDAHRK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |