C15H20Cl2N2O2 — CID 115536709
methyl 2-[cyclopentyl-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]amino]acetate (PubChem CID 115536709) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is methyl 2-[cyclopentyl-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]amino]acetate.
| Compound Name | methyl 2-[cyclopentyl-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 115536709 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | methyl 2-[cyclopentyl-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1c(Cl)cc(C)nc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-10-7-13(16)12(15(17)18-10)8-19(9-14(20)21-2)11-5-3-4-6-11/h7,11H,3-6,8-9H2,1-2H3 |
| InChIKey | PRPWSFHWHHWWRJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|