2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid

C12H13F2NO2 — CID 55045230

IUPAC2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid
SMILESO=C(O)CN(Cc1ccc(F)cc1F)C1CC1
InChIInChI=1S/C12H13F2NO2/c13-9-2-1-8(11(14)5-9)6-15(7-12(16)17)10-3-4-10/h1-2,5,10H,3-4,6-7H2,(H,16,17)
InChIKeyGJWRAQPOUKXHKR-UHFFFAOYSA-N
MW241.24 g/mol
LogP2.01
Rot. Bonds5

About 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid

2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid (PubChem CID 55045230) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid.

Molecular Properties

Compound Name2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid
PubChem CID55045230
Molecular FormulaC12H13F2NO2
Molecular Weight241.24 g/mol
Exact Mass241.09
IUPAC Name2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid
SMILESO=C(O)CN(Cc1ccc(F)cc1F)C1CC1
InChIInChI=1S/C12H13F2NO2/c13-9-2-1-8(11(14)5-9)6-15(7-12(16)17)10-3-4-10/h1-2,5,10H,3-4,6-7H2,(H,16,17)
InChIKeyGJWRAQPOUKXHKR-UHFFFAOYSA-N
XLogP2.01
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.24
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid?
The IUPAC name of 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid (CID 55045230) is 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid.
What is the SMILES notation for 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid?
The canonical SMILES for 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid is O=C(O)CN(Cc1ccc(F)cc1F)C1CC1.
What is the InChIKey of 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid?
The InChIKey is GJWRAQPOUKXHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO2/c13-9-2-1-8(11(14)5-9)6-15(7-12(16)17)10-3-4-10/h1-2,5,10H,3-4,6-7H2,(H,16,17).
What are the key properties of 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid?
2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid has a molecular weight of 241.24 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid is sourced from PubChem (CID 55045230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).