C12H13F2NO2 — CID 55045230
2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid (PubChem CID 55045230) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 55045230 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[cyclopropyl-[(2,4-difluorophenyl)methyl]amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C12H13F2NO2/c13-9-2-1-8(11(14)5-9)6-15(7-12(16)17)10-3-4-10/h1-2,5,10H,3-4,6-7H2,(H,16,17) |
| InChIKey | GJWRAQPOUKXHKR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |