C10H12F2N2O2S — CID 112686080
1-[[cyclopropyl(sulfamoyl)amino]methyl]-2,4-difluorobenzene (PubChem CID 112686080) has the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. Its IUPAC name is 1-[[cyclopropyl(sulfamoyl)amino]methyl]-2,4-difluorobenzene.
| Compound Name | 1-[[cyclopropyl(sulfamoyl)amino]methyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 112686080 |
| Molecular Formula | C10H12F2N2O2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-[[cyclopropyl(sulfamoyl)amino]methyl]-2,4-difluorobenzene |
| SMILES | NS(=O)(=O)N(Cc1ccc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C10H12F2N2O2S/c11-8-2-1-7(10(12)5-8)6-14(9-3-4-9)17(13,15)16/h1-2,5,9H,3-4,6H2,(H2,13,15,16) |
| InChIKey | OBCUADVHXPJSDO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |