C11H12BrF2NO2S — CID 80667040
N-(2-bromoethyl)-N-cyclopropyl-2,4-difluorobenzenesulfonamide (PubChem CID 80667040) has the molecular formula C11H12BrF2NO2S and a molecular weight of 340.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclopropyl-2,4-difluorobenzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-N-cyclopropyl-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 80667040 |
| Molecular Formula | C11H12BrF2NO2S |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclopropyl-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N(CCBr)C1CC1 |
| InChI | InChI=1S/C11H12BrF2NO2S/c12-5-6-15(9-2-3-9)18(16,17)11-4-1-8(13)7-10(11)14/h1,4,7,9H,2-3,5-6H2 |
| InChIKey | LNDCSPAGXLKFDL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|