C10H12BrF2NO2S — CID 106441786
N-(3-bromopropyl)-2,4-difluoro-N-methylbenzenesulfonamide (PubChem CID 106441786) has the molecular formula C10H12BrF2NO2S and a molecular weight of 328.18 g/mol. Its IUPAC name is N-(3-bromopropyl)-2,4-difluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(3-bromopropyl)-2,4-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106441786 |
| Molecular Formula | C10H12BrF2NO2S |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | N-(3-bromopropyl)-2,4-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(CCCBr)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H12BrF2NO2S/c1-14(6-2-5-11)17(15,16)10-4-3-8(12)7-9(10)13/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | VVQILSOMIWYMHG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|