C12H17ClFNO3S — CID 79187004
4-(chloromethyl)-2-fluoro-N-(3-methoxypropyl)-N-methylbenzenesulfonamide (PubChem CID 79187004) has the molecular formula C12H17ClFNO3S and a molecular weight of 309.79 g/mol. Its IUPAC name is 4-(chloromethyl)-2-fluoro-N-(3-methoxypropyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-(chloromethyl)-2-fluoro-N-(3-methoxypropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79187004 |
| Molecular Formula | C12H17ClFNO3S |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-(chloromethyl)-2-fluoro-N-(3-methoxypropyl)-N-methylbenzenesulfonamide |
| SMILES | COCCCN(C)S(=O)(=O)c1ccc(CCl)cc1F |
| InChI | InChI=1S/C12H17ClFNO3S/c1-15(6-3-7-18-2)19(16,17)12-5-4-10(9-13)8-11(12)14/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | ZOBSDYLMVBDNBC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|